About 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine
1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 61287502) has the molecular formula C12H17NOS
and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine.
Molecular Properties
| Compound Name | 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine |
| PubChem CID | 61287502 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CC(C)c1ccc2c(c1)C(N)CCS2=O |
| InChI | InChI=1S/C12H17NOS/c1-8(2)9-3-4-12-10(7-9)11(13)5-6-15(12)14/h3-4,7-8,11H,5-6,13H2,1-2H3 |
| InChIKey | IPXLCSLPKJIWKD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine?
The IUPAC name of 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine (CID 61287502) is 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine.
What is the SMILES notation for 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine?
The canonical SMILES for 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine is CC(C)c1ccc2c(c1)C(N)CCS2=O.
What is the InChIKey of 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine?
The InChIKey is IPXLCSLPKJIWKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS/c1-8(2)9-3-4-12-10(7-9)11(13)5-6-15(12)14/h3-4,7-8,11H,5-6,13H2,1-2H3.
What are the key properties of 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine?
1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine has a molecular weight of 223.34 g/mol, XLogP of 2.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-6-propan-2-yl-3,4-dihydro-2H-thiochromen-4-amine is sourced from PubChem (CID 61287502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).