About 4-(3-bromopropyl)-2,2-dimethylmorpholine
4-(3-bromopropyl)-2,2-dimethylmorpholine (PubChem CID 61287955) has the molecular formula C9H18BrNO
and a molecular weight of 236.15 g/mol. Its IUPAC name is 4-(3-bromopropyl)-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(3-bromopropyl)-2,2-dimethylmorpholine |
| PubChem CID | 61287955 |
| Molecular Formula | C9H18BrNO |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 4-(3-bromopropyl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(CCCBr)CCO1 |
| InChI | InChI=1S/C9H18BrNO/c1-9(2)8-11(5-3-4-10)6-7-12-9/h3-8H2,1-2H3 |
| InChIKey | GFIOZQWQBDWLOU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-bromopropyl)-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromopropyl)-2,2-dimethylmorpholine?
The IUPAC name of 4-(3-bromopropyl)-2,2-dimethylmorpholine (CID 61287955) is 4-(3-bromopropyl)-2,2-dimethylmorpholine.
What is the SMILES notation for 4-(3-bromopropyl)-2,2-dimethylmorpholine?
The canonical SMILES for 4-(3-bromopropyl)-2,2-dimethylmorpholine is CC1(C)CN(CCCBr)CCO1.
What is the InChIKey of 4-(3-bromopropyl)-2,2-dimethylmorpholine?
The InChIKey is GFIOZQWQBDWLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18BrNO/c1-9(2)8-11(5-3-4-10)6-7-12-9/h3-8H2,1-2H3.
What are the key properties of 4-(3-bromopropyl)-2,2-dimethylmorpholine?
4-(3-bromopropyl)-2,2-dimethylmorpholine has a molecular weight of 236.15 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromopropyl)-2,2-dimethylmorpholine is sourced from PubChem (CID 61287955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).