C15H15F2NO2S — CID 61288253
3-[(2,5-difluorophenyl)sulfinylmethyl]-4-ethoxyaniline (PubChem CID 61288253) has the molecular formula C15H15F2NO2S and a molecular weight of 311.35 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)sulfinylmethyl]-4-ethoxyaniline.
| Compound Name | 3-[(2,5-difluorophenyl)sulfinylmethyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 61288253 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 3-[(2,5-difluorophenyl)sulfinylmethyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(N)cc1CS(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H15F2NO2S/c1-2-20-14-6-4-12(18)7-10(14)9-21(19)15-8-11(16)3-5-13(15)17/h3-8H,2,9,18H2,1H3 |
| InChIKey | HRTYQYUHURZHEA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|