About 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid
1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid (PubChem CID 61289956) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid |
| PubChem CID | 61289956 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid |
| SMILES | CC=CC=CC(=O)NC1(C(=O)O)CCCC(C)C1 |
| InChI | InChI=1S/C14H21NO3/c1-3-4-5-8-12(16)15-14(13(17)18)9-6-7-11(2)10-14/h3-5,8,11H,6-7,9-10H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | PBUIAFJYFONWIH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid?
The IUPAC name of 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid (CID 61289956) is 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid is CC=CC=CC(=O)NC1(C(=O)O)CCCC(C)C1.
What is the InChIKey of 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid?
The InChIKey is PBUIAFJYFONWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-3-4-5-8-12(16)15-14(13(17)18)9-6-7-11(2)10-14/h3-5,8,11H,6-7,9-10H2,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid?
1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid has a molecular weight of 251.33 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hexa-2,4-dienoylamino)-3-methylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 61289956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).