C11H15NO4 — CID 61291210
1-(3-methyl-2,5-dioxopyrrolidin-1-yl)cyclopentane-1-carboxylic acid (PubChem CID 61291210) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 1-(3-methyl-2,5-dioxopyrrolidin-1-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(3-methyl-2,5-dioxopyrrolidin-1-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 61291210 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-(3-methyl-2,5-dioxopyrrolidin-1-yl)cyclopentane-1-carboxylic acid |
| SMILES | CC1CC(=O)N(C2(C(=O)O)CCCC2)C1=O |
| InChI | InChI=1S/C11H15NO4/c1-7-6-8(13)12(9(7)14)11(10(15)16)4-2-3-5-11/h7H,2-6H2,1H3,(H,15,16) |
| InChIKey | OIJAGPRGZAWICA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|