C13H20F3NO4 — CID 61291265
3-methyl-1-[3-(2,2,2-trifluoroethoxy)propanoylamino]cyclohexane-1-carboxylic acid (PubChem CID 61291265) has the molecular formula C13H20F3NO4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 3-methyl-1-[3-(2,2,2-trifluoroethoxy)propanoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-methyl-1-[3-(2,2,2-trifluoroethoxy)propanoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 61291265 |
| Molecular Formula | C13H20F3NO4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-methyl-1-[3-(2,2,2-trifluoroethoxy)propanoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CC1CCCC(NC(=O)CCOCC(F)(F)F)(C(=O)O)C1 |
| InChI | InChI=1S/C13H20F3NO4/c1-9-3-2-5-12(7-9,11(19)20)17-10(18)4-6-21-8-13(14,15)16/h9H,2-8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | DMZAWBRMZKEQNE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|