About 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine
8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 61292064) has the molecular formula C11H15NOS
and a molecular weight of 209.31 g/mol. Its IUPAC name is 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine.
Molecular Properties
| Compound Name | 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine |
| PubChem CID | 61292064 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CNC1CCSc2c(OC)cccc21 |
| InChI | InChI=1S/C11H15NOS/c1-12-9-6-7-14-11-8(9)4-3-5-10(11)13-2/h3-5,9,12H,6-7H2,1-2H3 |
| InChIKey | RTYBJAAGSRAFNZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine?
The IUPAC name of 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine (CID 61292064) is 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine.
What is the SMILES notation for 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine?
The canonical SMILES for 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine is CNC1CCSc2c(OC)cccc21.
What is the InChIKey of 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine?
The InChIKey is RTYBJAAGSRAFNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS/c1-12-9-6-7-14-11-8(9)4-3-5-10(11)13-2/h3-5,9,12H,6-7H2,1-2H3.
What are the key properties of 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine?
8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine has a molecular weight of 209.31 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-N-methyl-3,4-dihydro-2H-thiochromen-4-amine is sourced from PubChem (CID 61292064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).