C13H14FN3O2S — CID 61293161
N-(5-amino-4-methyl-2-pyridinyl)-5-fluoro-2-methylbenzenesulfonamide (PubChem CID 61293161) has the molecular formula C13H14FN3O2S and a molecular weight of 295.34 g/mol. Its IUPAC name is N-(5-amino-4-methyl-2-pyridinyl)-5-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-(5-amino-4-methyl-2-pyridinyl)-5-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61293161 |
| Molecular Formula | C13H14FN3O2S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-(5-amino-4-methyl-2-pyridinyl)-5-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(F)ccc2C)ncc1N |
| InChI | InChI=1S/C13H14FN3O2S/c1-8-3-4-10(14)6-12(8)20(18,19)17-13-5-9(2)11(15)7-16-13/h3-7H,15H2,1-2H3,(H,16,17) |
| InChIKey | DMZKPJCORLUKGG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |