C16H19ClN2O2 — CID 61293928
3-(3-chloro-4-methylphenyl)-7-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 61293928) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-7-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(3-chloro-4-methylphenyl)-7-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 61293928 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-7-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)NC3(CCCC(C)C3)C2=O)cc1Cl |
| InChI | InChI=1S/C16H19ClN2O2/c1-10-4-3-7-16(9-10)14(20)19(15(21)18-16)12-6-5-11(2)13(17)8-12/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,18,21) |
| InChIKey | UOIUSNHTJOGHHN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|