C14H12ClFN2O3 — CID 61294193
N-(2-chloro-4,5-dimethoxyphenyl)-2-fluoropyridine-4-carboxamide (PubChem CID 61294193) has the molecular formula C14H12ClFN2O3 and a molecular weight of 310.71 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-2-fluoropyridine-4-carboxamide.
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 61294193 |
| Molecular Formula | C14H12ClFN2O3 |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-fluoropyridine-4-carboxamide |
| SMILES | COc1cc(Cl)c(NC(=O)c2ccnc(F)c2)cc1OC |
| InChI | InChI=1S/C14H12ClFN2O3/c1-20-11-6-9(15)10(7-12(11)21-2)18-14(19)8-3-4-17-13(16)5-8/h3-7H,1-2H3,(H,18,19) |
| InChIKey | PINYLEINUMCNNS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|