C10H14FN3O — CID 61294521
N-[2-(dimethylamino)ethyl]-2-fluoropyridine-4-carboxamide (PubChem CID 61294521) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 61294521 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-fluoropyridine-4-carboxamide |
| SMILES | CN(C)CCNC(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C10H14FN3O/c1-14(2)6-5-13-10(15)8-3-4-12-9(11)7-8/h3-4,7H,5-6H2,1-2H3,(H,13,15) |
| InChIKey | MJYKVRWBOVSROY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|