2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid

C12H14N2O2S — CID 61294642

IUPAC2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid
SMILESCc1nn(Cc2ccsc2)c(C)c1CC(=O)O
InChIInChI=1S/C12H14N2O2S/c1-8-11(5-12(15)16)9(2)14(13-8)6-10-3-4-17-7-10/h3-4,7H,5-6H2,1-2H3,(H,15,16)
InChIKeyGXZOBCZLHAJWPS-UHFFFAOYSA-N
MW250.32 g/mol
LogP2.24
Rot. Bonds4

About 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid

2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid (PubChem CID 61294642) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid
PubChem CID61294642
Molecular FormulaC12H14N2O2S
Molecular Weight250.32 g/mol
Exact Mass250.08
IUPAC Name2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid
SMILESCc1nn(Cc2ccsc2)c(C)c1CC(=O)O
InChIInChI=1S/C12H14N2O2S/c1-8-11(5-12(15)16)9(2)14(13-8)6-10-3-4-17-7-10/h3-4,7H,5-6H2,1-2H3,(H,15,16)
InChIKeyGXZOBCZLHAJWPS-UHFFFAOYSA-N
XLogP2.24
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.32
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid?
The IUPAC name of 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid (CID 61294642) is 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid.
What is the SMILES notation for 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid?
The canonical SMILES for 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid is Cc1nn(Cc2ccsc2)c(C)c1CC(=O)O.
What is the InChIKey of 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid?
The InChIKey is GXZOBCZLHAJWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2S/c1-8-11(5-12(15)16)9(2)14(13-8)6-10-3-4-17-7-10/h3-4,7H,5-6H2,1-2H3,(H,15,16).
What are the key properties of 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid?
2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid has a molecular weight of 250.32 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dimethyl-1-(thiophen-3-ylmethyl)pyrazol-4-yl]acetic acid is sourced from PubChem (CID 61294642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).