C13H20BrN3O — CID 61295504
(3-aminopiperidin-1-yl)-(4-bromo-1-propylpyrrol-2-yl)methanone (PubChem CID 61295504) has the molecular formula C13H20BrN3O and a molecular weight of 314.23 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(4-bromo-1-propylpyrrol-2-yl)methanone.
| Compound Name | (3-aminopiperidin-1-yl)-(4-bromo-1-propylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 61295504 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(4-bromo-1-propylpyrrol-2-yl)methanone |
| SMILES | CCCn1cc(Br)cc1C(=O)N1CCCC(N)C1 |
| InChI | InChI=1S/C13H20BrN3O/c1-2-5-16-8-10(14)7-12(16)13(18)17-6-3-4-11(15)9-17/h7-8,11H,2-6,9,15H2,1H3 |
| InChIKey | XMRUVIHMUWEBLW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |