About 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile
5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile (PubChem CID 61295840) has the molecular formula C11H10N6S
and a molecular weight of 258.31 g/mol. Its IUPAC name is 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile.
Molecular Properties
| Compound Name | 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile |
| PubChem CID | 61295840 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile |
| SMILES | N#Cc1cc(N)ccc1Sc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C11H10N6S/c12-5-6-3-7(13)1-2-8(6)18-11-16-9(14)4-10(15)17-11/h1-4H,13H2,(H4,14,15,16,17) |
| InChIKey | CVCSZHJEMGEAIR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile?
The IUPAC name of 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile (CID 61295840) is 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile.
What is the SMILES notation for 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile?
The canonical SMILES for 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile is N#Cc1cc(N)ccc1Sc1nc(N)cc(N)n1.
What is the InChIKey of 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile?
The InChIKey is CVCSZHJEMGEAIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6S/c12-5-6-3-7(13)1-2-8(6)18-11-16-9(14)4-10(15)17-11/h1-4H,13H2,(H4,14,15,16,17).
What are the key properties of 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile?
5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile has a molecular weight of 258.31 g/mol, XLogP of 1.25, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(4,6-diaminopyrimidin-2-yl)sulfanylbenzonitrile is sourced from PubChem (CID 61295840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).