C15H20N2O — CID 61298118
(3-aminopiperidin-1-yl)-(2,3-dihydro-1H-inden-5-yl)methanone (PubChem CID 61298118) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-(2,3-dihydro-1H-inden-5-yl)methanone.
| Compound Name | (3-aminopiperidin-1-yl)-(2,3-dihydro-1H-inden-5-yl)methanone |
|---|---|
| PubChem CID | 61298118 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (3-aminopiperidin-1-yl)-(2,3-dihydro-1H-inden-5-yl)methanone |
| SMILES | NC1CCCN(C(=O)c2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C15H20N2O/c16-14-5-2-8-17(10-14)15(18)13-7-6-11-3-1-4-12(11)9-13/h6-7,9,14H,1-5,8,10,16H2 |
| InChIKey | RATWBMBXHJMGHQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |