C8H10N4O2S2 — CID 61298608
4-amino-N-(1-methylpyrazol-3-yl)thiophene-2-sulfonamide (PubChem CID 61298608) has the molecular formula C8H10N4O2S2 and a molecular weight of 258.33 g/mol. Its IUPAC name is 4-amino-N-(1-methylpyrazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-(1-methylpyrazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61298608 |
| Molecular Formula | C8H10N4O2S2 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 4-amino-N-(1-methylpyrazol-3-yl)thiophene-2-sulfonamide |
| SMILES | Cn1ccc(NS(=O)(=O)c2cc(N)cs2)n1 |
| InChI | InChI=1S/C8H10N4O2S2/c1-12-3-2-7(10-12)11-16(13,14)8-4-6(9)5-15-8/h2-5H,9H2,1H3,(H,10,11) |
| InChIKey | GZGPLSBOHZPTKK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |