C12H16BrFN2O — CID 61298886
2-amino-N-[(5-bromo-2-fluorophenyl)methyl]-3-methylbutanamide (PubChem CID 61298886) has the molecular formula C12H16BrFN2O and a molecular weight of 303.18 g/mol. Its IUPAC name is 2-amino-N-[(5-bromo-2-fluorophenyl)methyl]-3-methylbutanamide.
| Compound Name | 2-amino-N-[(5-bromo-2-fluorophenyl)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 61298886 |
| Molecular Formula | C12H16BrFN2O |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-amino-N-[(5-bromo-2-fluorophenyl)methyl]-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H16BrFN2O/c1-7(2)11(15)12(17)16-6-8-5-9(13)3-4-10(8)14/h3-5,7,11H,6,15H2,1-2H3,(H,16,17) |
| InChIKey | VIQFOKAMOMTGMW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |