About 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide
4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 61298988) has the molecular formula C6H6N4O2S3
and a molecular weight of 262.34 g/mol. Its IUPAC name is 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide |
| PubChem CID | 61298988 |
| Molecular Formula | C6H6N4O2S3 |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | Nc1csc(S(=O)(=O)Nc2nncs2)c1 |
| InChI | InChI=1S/C6H6N4O2S3/c7-4-1-5(13-2-4)15(11,12)10-6-9-8-3-14-6/h1-3H,7H2,(H,9,10) |
| InChIKey | ZTPFMINMRNODAZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide?
The IUPAC name of 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide (CID 61298988) is 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide?
The canonical SMILES for 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide is Nc1csc(S(=O)(=O)Nc2nncs2)c1.
What is the InChIKey of 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide?
The InChIKey is ZTPFMINMRNODAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2S3/c7-4-1-5(13-2-4)15(11,12)10-6-9-8-3-14-6/h1-3H,7H2,(H,9,10).
What are the key properties of 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide?
4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide has a molecular weight of 262.34 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(1,3,4-thiadiazol-2-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 61298988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).