About 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide
4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide (PubChem CID 61299610) has the molecular formula C10H12N4O2S2
and a molecular weight of 284.37 g/mol. Its IUPAC name is 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide |
| PubChem CID | 61299610 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C10H12N4O2S2/c11-3-1-5-14(6-2-4-12)18(15,16)10-7-9(13)8-17-10/h7-8H,1-2,5-6,13H2 |
| InChIKey | VEWJGHLUQMYXQB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide?
The IUPAC name of 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide (CID 61299610) is 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide.
What is the SMILES notation for 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide?
The canonical SMILES for 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide is N#CCCN(CCC#N)S(=O)(=O)c1cc(N)cs1.
What is the InChIKey of 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide?
The InChIKey is VEWJGHLUQMYXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O2S2/c11-3-1-5-14(6-2-4-12)18(15,16)10-7-9(13)8-17-10/h7-8H,1-2,5-6,13H2.
What are the key properties of 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide?
4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide has a molecular weight of 284.37 g/mol, XLogP of 1.15, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,N-bis(2-cyanoethyl)thiophene-2-sulfonamide is sourced from PubChem (CID 61299610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).