C13H14BrFN2O2 — CID 61299860
3-[(5-bromo-2-fluorophenyl)methylamino]-1-ethylpyrrolidine-2,5-dione (PubChem CID 61299860) has the molecular formula C13H14BrFN2O2 and a molecular weight of 329.17 g/mol. Its IUPAC name is 3-[(5-bromo-2-fluorophenyl)methylamino]-1-ethylpyrrolidine-2,5-dione.
| Compound Name | 3-[(5-bromo-2-fluorophenyl)methylamino]-1-ethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61299860 |
| Molecular Formula | C13H14BrFN2O2 |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 3-[(5-bromo-2-fluorophenyl)methylamino]-1-ethylpyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)CC(NCc2cc(Br)ccc2F)C1=O |
| InChI | InChI=1S/C13H14BrFN2O2/c1-2-17-12(18)6-11(13(17)19)16-7-8-5-9(14)3-4-10(8)15/h3-5,11,16H,2,6-7H2,1H3 |
| InChIKey | VDFNWDNEXCAGMJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|