C11H11BrFN3O2S — CID 61301023
N-[(5-bromo-2-fluorophenyl)methyl]-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 61301023) has the molecular formula C11H11BrFN3O2S and a molecular weight of 348.20 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61301023 |
| Molecular Formula | C11H11BrFN3O2S |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C11H11BrFN3O2S/c1-7-11(6-14-16-7)19(17,18)15-5-8-4-9(12)2-3-10(8)13/h2-4,6,15H,5H2,1H3,(H,14,16) |
| InChIKey | CNFHTCRGYRLKKI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |