About heptyl 2-aminopentanoate
heptyl 2-aminopentanoate (PubChem CID 61302463) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is heptyl 2-aminopentanoate.
Molecular Properties
| Compound Name | heptyl 2-aminopentanoate |
| PubChem CID | 61302463 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | heptyl 2-aminopentanoate |
| SMILES | CCCCCCCOC(=O)C(N)CCC |
| InChI | InChI=1S/C12H25NO2/c1-3-5-6-7-8-10-15-12(14)11(13)9-4-2/h11H,3-10,13H2,1-2H3 |
| InChIKey | VFMXOVSGGQHRCY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptyl 2-aminopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl 2-aminopentanoate?
The IUPAC name of heptyl 2-aminopentanoate (CID 61302463) is heptyl 2-aminopentanoate.
What is the SMILES notation for heptyl 2-aminopentanoate?
The canonical SMILES for heptyl 2-aminopentanoate is CCCCCCCOC(=O)C(N)CCC.
What is the InChIKey of heptyl 2-aminopentanoate?
The InChIKey is VFMXOVSGGQHRCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-3-5-6-7-8-10-15-12(14)11(13)9-4-2/h11H,3-10,13H2,1-2H3.
What are the key properties of heptyl 2-aminopentanoate?
heptyl 2-aminopentanoate has a molecular weight of 215.34 g/mol, XLogP of 2.63, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl 2-aminopentanoate is sourced from PubChem (CID 61302463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).