C16H19NO2S — CID 61302605
4-[2-(3,4-dimethylphenyl)sulfinylethoxy]aniline (PubChem CID 61302605) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 4-[2-(3,4-dimethylphenyl)sulfinylethoxy]aniline.
| Compound Name | 4-[2-(3,4-dimethylphenyl)sulfinylethoxy]aniline |
|---|---|
| PubChem CID | 61302605 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[2-(3,4-dimethylphenyl)sulfinylethoxy]aniline |
| SMILES | Cc1ccc(S(=O)CCOc2ccc(N)cc2)cc1C |
| InChI | InChI=1S/C16H19NO2S/c1-12-3-8-16(11-13(12)2)20(18)10-9-19-15-6-4-14(17)5-7-15/h3-8,11H,9-10,17H2,1-2H3 |
| InChIKey | VSBBEXKSEGLTCV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|