methyl 3-(4-fluorophenyl)sulfinylpropanoate

C10H11FO3S — CID 61302731

IUPACmethyl 3-(4-fluorophenyl)sulfinylpropanoate
SMILESCOC(=O)CCS(=O)c1ccc(F)cc1
InChIInChI=1S/C10H11FO3S/c1-14-10(12)6-7-15(13)9-4-2-8(11)3-5-9/h2-5H,6-7H2,1H3
InChIKeyBJEVJAQLNODGEZ-UHFFFAOYSA-N
MW230.26 g/mol
LogP1.50
Rot. Bonds4

About methyl 3-(4-fluorophenyl)sulfinylpropanoate

methyl 3-(4-fluorophenyl)sulfinylpropanoate (PubChem CID 61302731) has the molecular formula C10H11FO3S and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl 3-(4-fluorophenyl)sulfinylpropanoate.

Molecular Properties

Compound Namemethyl 3-(4-fluorophenyl)sulfinylpropanoate
PubChem CID61302731
Molecular FormulaC10H11FO3S
Molecular Weight230.26 g/mol
Exact Mass230.04
IUPAC Namemethyl 3-(4-fluorophenyl)sulfinylpropanoate
SMILESCOC(=O)CCS(=O)c1ccc(F)cc1
InChIInChI=1S/C10H11FO3S/c1-14-10(12)6-7-15(13)9-4-2-8(11)3-5-9/h2-5H,6-7H2,1H3
InChIKeyBJEVJAQLNODGEZ-UHFFFAOYSA-N
XLogP1.50
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.26
LogP ≤ 51.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-(4-fluorophenyl)sulfinylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4-fluorophenyl)sulfinylpropanoate?
The IUPAC name of methyl 3-(4-fluorophenyl)sulfinylpropanoate (CID 61302731) is methyl 3-(4-fluorophenyl)sulfinylpropanoate.
What is the SMILES notation for methyl 3-(4-fluorophenyl)sulfinylpropanoate?
The canonical SMILES for methyl 3-(4-fluorophenyl)sulfinylpropanoate is COC(=O)CCS(=O)c1ccc(F)cc1.
What is the InChIKey of methyl 3-(4-fluorophenyl)sulfinylpropanoate?
The InChIKey is BJEVJAQLNODGEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO3S/c1-14-10(12)6-7-15(13)9-4-2-8(11)3-5-9/h2-5H,6-7H2,1H3.
What are the key properties of methyl 3-(4-fluorophenyl)sulfinylpropanoate?
methyl 3-(4-fluorophenyl)sulfinylpropanoate has a molecular weight of 230.26 g/mol, XLogP of 1.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-fluorophenyl)sulfinylpropanoate is sourced from PubChem (CID 61302731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).