About 1-benzylphthalazine
1-benzylphthalazine (PubChem CID 613038) has the molecular formula C15H12N2
and a molecular weight of 220.28 g/mol. Its IUPAC name is 1-benzylphthalazine.
Molecular Properties
| Compound Name | 1-benzylphthalazine |
| PubChem CID | 613038 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-benzylphthalazine |
| SMILES | c1ccc(Cc2nncc3ccccc23)cc1 |
| InChI | InChI=1S/C15H12N2/c1-2-6-12(7-3-1)10-15-14-9-5-4-8-13(14)11-16-17-15/h1-9,11H,10H2 |
| InChIKey | VQPBLPKQGMFEEB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylphthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylphthalazine?
The IUPAC name of 1-benzylphthalazine (CID 613038) is 1-benzylphthalazine.
What is the SMILES notation for 1-benzylphthalazine?
The canonical SMILES for 1-benzylphthalazine is c1ccc(Cc2nncc3ccccc23)cc1.
What is the InChIKey of 1-benzylphthalazine?
The InChIKey is VQPBLPKQGMFEEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2/c1-2-6-12(7-3-1)10-15-14-9-5-4-8-13(14)11-16-17-15/h1-9,11H,10H2.
What are the key properties of 1-benzylphthalazine?
1-benzylphthalazine has a molecular weight of 220.28 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylphthalazine is sourced from PubChem (CID 613038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).