About 2-propylsulfinylbutanoic acid
2-propylsulfinylbutanoic acid (PubChem CID 61304744) has the molecular formula C7H14O3S
and a molecular weight of 178.25 g/mol. Its IUPAC name is 2-propylsulfinylbutanoic acid.
Molecular Properties
| Compound Name | 2-propylsulfinylbutanoic acid |
| PubChem CID | 61304744 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-propylsulfinylbutanoic acid |
| SMILES | CCCS(=O)C(CC)C(=O)O |
| InChI | InChI=1S/C7H14O3S/c1-3-5-11(10)6(4-2)7(8)9/h6H,3-5H2,1-2H3,(H,8,9) |
| InChIKey | JUMJGEAPTHBQCC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propylsulfinylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfinylbutanoic acid?
The IUPAC name of 2-propylsulfinylbutanoic acid (CID 61304744) is 2-propylsulfinylbutanoic acid.
What is the SMILES notation for 2-propylsulfinylbutanoic acid?
The canonical SMILES for 2-propylsulfinylbutanoic acid is CCCS(=O)C(CC)C(=O)O.
What is the InChIKey of 2-propylsulfinylbutanoic acid?
The InChIKey is JUMJGEAPTHBQCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3S/c1-3-5-11(10)6(4-2)7(8)9/h6H,3-5H2,1-2H3,(H,8,9).
What are the key properties of 2-propylsulfinylbutanoic acid?
2-propylsulfinylbutanoic acid has a molecular weight of 178.25 g/mol, XLogP of 1.01, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfinylbutanoic acid is sourced from PubChem (CID 61304744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).