About 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid
6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 61305044) has the molecular formula C13H9N3O3S2
and a molecular weight of 319.37 g/mol. Its IUPAC name is 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid |
| PubChem CID | 61305044 |
| Molecular Formula | C13H9N3O3S2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(SCc2noc(-c3ccsc3)n2)nc1 |
| InChI | InChI=1S/C13H9N3O3S2/c17-13(18)8-1-2-11(14-5-8)21-7-10-15-12(19-16-10)9-3-4-20-6-9/h1-6H,7H2,(H,17,18) |
| InChIKey | VZILOQHZFAGLFP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid?
The IUPAC name of 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid (CID 61305044) is 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid is O=C(O)c1ccc(SCc2noc(-c3ccsc3)n2)nc1.
What is the InChIKey of 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid?
The InChIKey is VZILOQHZFAGLFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O3S2/c17-13(18)8-1-2-11(14-5-8)21-7-10-15-12(19-16-10)9-3-4-20-6-9/h1-6H,7H2,(H,17,18).
What are the key properties of 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid?
6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid has a molecular weight of 319.37 g/mol, XLogP of 3.18, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-thiophen-3-yl-1,2,4-oxadiazol-3-yl)methylsulfanyl]pyridine-3-carboxylic acid is sourced from PubChem (CID 61305044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).