C16H24N2O2 — CID 61305643
methyl 3-amino-4-[(2,3-dimethylcyclohexyl)amino]benzoate (PubChem CID 61305643) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is methyl 3-amino-4-[(2,3-dimethylcyclohexyl)amino]benzoate.
| Compound Name | methyl 3-amino-4-[(2,3-dimethylcyclohexyl)amino]benzoate |
|---|---|
| PubChem CID | 61305643 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | methyl 3-amino-4-[(2,3-dimethylcyclohexyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC2CCCC(C)C2C)c(N)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-10-5-4-6-14(11(10)2)18-15-8-7-12(9-13(15)17)16(19)20-3/h7-11,14,18H,4-6,17H2,1-3H3 |
| InChIKey | ZEIDBWOKEGMSBH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|