About 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate
2-propan-2-yloxyethyl 2-amino-6-methylbenzoate (PubChem CID 61308511) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate.
Molecular Properties
| Compound Name | 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate |
| PubChem CID | 61308511 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate |
| SMILES | Cc1cccc(N)c1C(=O)OCCOC(C)C |
| InChI | InChI=1S/C13H19NO3/c1-9(2)16-7-8-17-13(15)12-10(3)5-4-6-11(12)14/h4-6,9H,7-8,14H2,1-3H3 |
| InChIKey | POCAUWZSELERMB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate?
The IUPAC name of 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate (CID 61308511) is 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate.
What is the SMILES notation for 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate?
The canonical SMILES for 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate is Cc1cccc(N)c1C(=O)OCCOC(C)C.
What is the InChIKey of 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate?
The InChIKey is POCAUWZSELERMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-9(2)16-7-8-17-13(15)12-10(3)5-4-6-11(12)14/h4-6,9H,7-8,14H2,1-3H3.
What are the key properties of 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate?
2-propan-2-yloxyethyl 2-amino-6-methylbenzoate has a molecular weight of 237.30 g/mol, XLogP of 2.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyethyl 2-amino-6-methylbenzoate is sourced from PubChem (CID 61308511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).