About (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate
(5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate (PubChem CID 61308700) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| PubChem CID | 61308700 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)Cn2cnc(N)n2)C1 |
| InChI | InChI=1S/C14H24N4O2/c1-9(2)11-5-4-10(3)6-12(11)20-13(19)7-18-8-16-14(15)17-18/h8-12H,4-7H2,1-3H3,(H2,15,17) |
| InChIKey | HQKHJFVOVBWIRE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The IUPAC name of (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate (CID 61308700) is (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate.
What is the SMILES notation for (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The canonical SMILES for (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate is CC1CCC(C(C)C)C(OC(=O)Cn2cnc(N)n2)C1.
What is the InChIKey of (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The InChIKey is HQKHJFVOVBWIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O2/c1-9(2)11-5-4-10(3)6-12(11)20-13(19)7-18-8-16-14(15)17-18/h8-12H,4-7H2,1-3H3,(H2,15,17).
What are the key properties of (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate?
(5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate has a molecular weight of 280.37 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate is sourced from PubChem (CID 61308700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).