About (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate
(4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate (PubChem CID 61309101) has the molecular formula C15H19N3O3
and a molecular weight of 289.34 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate |
| PubChem CID | 61309101 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate |
| SMILES | COc1ccc(COC(=O)Cn2nc(C)c(N)c2C)cc1 |
| InChI | InChI=1S/C15H19N3O3/c1-10-15(16)11(2)18(17-10)8-14(19)21-9-12-4-6-13(20-3)7-5-12/h4-7H,8-9,16H2,1-3H3 |
| InChIKey | VXAQUERACLFYHT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The IUPAC name of (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate (CID 61309101) is (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate.
What is the SMILES notation for (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The canonical SMILES for (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate is COc1ccc(COC(=O)Cn2nc(C)c(N)c2C)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The InChIKey is VXAQUERACLFYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3/c1-10-15(16)11(2)18(17-10)8-14(19)21-9-12-4-6-13(20-3)7-5-12/h4-7H,8-9,16H2,1-3H3.
What are the key properties of (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
(4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate has a molecular weight of 289.34 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate is sourced from PubChem (CID 61309101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).