About 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate
2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (PubChem CID 61309832) has the molecular formula C8H14N4O2
and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| PubChem CID | 61309832 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| SMILES | CC(C)COC(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C8H14N4O2/c1-6(2)4-14-7(13)3-12-5-10-8(9)11-12/h5-6H,3-4H2,1-2H3,(H2,9,11) |
| InChIKey | GJSDODWSXABBRL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The IUPAC name of 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (CID 61309832) is 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
What is the SMILES notation for 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The canonical SMILES for 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate is CC(C)COC(=O)Cn1cnc(N)n1.
What is the InChIKey of 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The InChIKey is GJSDODWSXABBRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2/c1-6(2)4-14-7(13)3-12-5-10-8(9)11-12/h5-6H,3-4H2,1-2H3,(H2,9,11).
What are the key properties of 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate has a molecular weight of 198.23 g/mol, XLogP of 0.06, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-(3-amino-1,2,4-triazol-1-yl)acetate is sourced from PubChem (CID 61309832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).