About heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate
heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (PubChem CID 61310048) has the molecular formula C11H20N4O2
and a molecular weight of 240.31 g/mol. Its IUPAC name is heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
Molecular Properties
| Compound Name | heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| PubChem CID | 61310048 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| SMILES | CCCCCCCOC(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C11H20N4O2/c1-2-3-4-5-6-7-17-10(16)8-15-9-13-11(12)14-15/h9H,2-8H2,1H3,(H2,12,14) |
| InChIKey | NCARJUBCCOPVTN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The IUPAC name of heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (CID 61310048) is heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
What is the SMILES notation for heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The canonical SMILES for heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate is CCCCCCCOC(=O)Cn1cnc(N)n1.
What is the InChIKey of heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The InChIKey is NCARJUBCCOPVTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O2/c1-2-3-4-5-6-7-17-10(16)8-15-9-13-11(12)14-15/h9H,2-8H2,1H3,(H2,12,14).
What are the key properties of heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate has a molecular weight of 240.31 g/mol, XLogP of 1.37, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl 2-(3-amino-1,2,4-triazol-1-yl)acetate is sourced from PubChem (CID 61310048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).