C13H16FN — CID 61310114
N-(4-fluorophenyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 61310114) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is N-(4-fluorophenyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-(4-fluorophenyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 61310114 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-(4-fluorophenyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | Fc1ccc(NC2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C13H16FN/c14-11-3-5-12(6-4-11)15-13-8-9-1-2-10(13)7-9/h3-6,9-10,13,15H,1-2,7-8H2 |
| InChIKey | KXJYBCJJKJFVCS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |