About (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate
(2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate (PubChem CID 61310432) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate |
| PubChem CID | 61310432 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate |
| SMILES | CCC1CCCCC1OC(=O)c1cc(N)c[nH]1 |
| InChI | InChI=1S/C13H20N2O2/c1-2-9-5-3-4-6-12(9)17-13(16)11-7-10(14)8-15-11/h7-9,12,15H,2-6,14H2,1H3 |
| InChIKey | WDPYTBQCVBVWJD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate?
The IUPAC name of (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate (CID 61310432) is (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate.
What is the SMILES notation for (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate?
The canonical SMILES for (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate is CCC1CCCCC1OC(=O)c1cc(N)c[nH]1.
What is the InChIKey of (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate?
The InChIKey is WDPYTBQCVBVWJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-2-9-5-3-4-6-12(9)17-13(16)11-7-10(14)8-15-11/h7-9,12,15H,2-6,14H2,1H3.
What are the key properties of (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate?
(2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate has a molecular weight of 236.31 g/mol, XLogP of 2.72, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylcyclohexyl) 4-amino-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 61310432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).