About (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate
(3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate (PubChem CID 61310469) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate.
Molecular Properties
| Compound Name | (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| PubChem CID | 61310469 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| SMILES | CC1CCCC(OC(=O)Cn2cnc(N)n2)C1 |
| InChI | InChI=1S/C11H18N4O2/c1-8-3-2-4-9(5-8)17-10(16)6-15-7-13-11(12)14-15/h7-9H,2-6H2,1H3,(H2,12,14) |
| InChIKey | VIEIRVOWTBCLNP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The IUPAC name of (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate (CID 61310469) is (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate.
What is the SMILES notation for (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The canonical SMILES for (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate is CC1CCCC(OC(=O)Cn2cnc(N)n2)C1.
What is the InChIKey of (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The InChIKey is VIEIRVOWTBCLNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2/c1-8-3-2-4-9(5-8)17-10(16)6-15-7-13-11(12)14-15/h7-9H,2-6H2,1H3,(H2,12,14).
What are the key properties of (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate?
(3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate has a molecular weight of 238.29 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 2-(3-amino-1,2,4-triazol-1-yl)acetate is sourced from PubChem (CID 61310469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).