C12H17FN4O — CID 61311404
2-[4-[(5-fluoro-2-pyridinyl)amino]piperidin-1-yl]acetamide (PubChem CID 61311404) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-[4-[(5-fluoro-2-pyridinyl)amino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[(5-fluoro-2-pyridinyl)amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 61311404 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[4-[(5-fluoro-2-pyridinyl)amino]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(Nc2ccc(F)cn2)CC1 |
| InChI | InChI=1S/C12H17FN4O/c13-9-1-2-12(15-7-9)16-10-3-5-17(6-4-10)8-11(14)18/h1-2,7,10H,3-6,8H2,(H2,14,18)(H,15,16) |
| InChIKey | RSZUZVBZSPATQM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |