C11H17FN2O — CID 61314147
3-[(5-fluoro-2-pyridinyl)-propan-2-ylamino]propan-1-ol (PubChem CID 61314147) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is 3-[(5-fluoro-2-pyridinyl)-propan-2-ylamino]propan-1-ol.
| Compound Name | 3-[(5-fluoro-2-pyridinyl)-propan-2-ylamino]propan-1-ol |
|---|---|
| PubChem CID | 61314147 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-[(5-fluoro-2-pyridinyl)-propan-2-ylamino]propan-1-ol |
| SMILES | CC(C)N(CCCO)c1ccc(F)cn1 |
| InChI | InChI=1S/C11H17FN2O/c1-9(2)14(6-3-7-15)11-5-4-10(12)8-13-11/h4-5,8-9,15H,3,6-7H2,1-2H3 |
| InChIKey | KZQZQGANUIPWKE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |