C25H26Cl2N2O4 — CID 6131569
(4E)-5-(2,4-dichlorophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 6131569) has the molecular formula C25H26Cl2N2O4 and a molecular weight of 489.40 g/mol. Its IUPAC name is (4E)-5-(2,4-dichlorophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(2,4-dichlorophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6131569 |
| Molecular Formula | C25H26Cl2N2O4 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (4E)-5-(2,4-dichlorophenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CC1Cc2cc(/C(O)=C3\C(=O)C(=O)N(CCCN(C)C)C3c3ccc(Cl)cc3Cl)ccc2O1 |
| InChI | InChI=1S/C25H26Cl2N2O4/c1-14-11-16-12-15(5-8-20(16)33-14)23(30)21-22(18-7-6-17(26)13-19(18)27)29(25(32)24(21)31)10-4-9-28(2)3/h5-8,12-14,22,30H,4,9-11H2,1-3H3/b23-21+ |
| InChIKey | WNGIKHGAXPEELK-XTQSDGFTSA-N |
| XLogP | 4.69 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|