About 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate
2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate (PubChem CID 61316388) has the molecular formula C8H9F2NO2S
and a molecular weight of 221.23 g/mol. Its IUPAC name is 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate |
| PubChem CID | 61316388 |
| Molecular Formula | C8H9F2NO2S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate |
| SMILES | Cc1sc(C(=O)OCC(F)F)cc1N |
| InChI | InChI=1S/C8H9F2NO2S/c1-4-5(11)2-6(14-4)8(12)13-3-7(9)10/h2,7H,3,11H2,1H3 |
| InChIKey | XFDFLCUXIFBSRQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate?
The IUPAC name of 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate (CID 61316388) is 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate.
What is the SMILES notation for 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate?
The canonical SMILES for 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate is Cc1sc(C(=O)OCC(F)F)cc1N.
What is the InChIKey of 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate?
The InChIKey is XFDFLCUXIFBSRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO2S/c1-4-5(11)2-6(14-4)8(12)13-3-7(9)10/h2,7H,3,11H2,1H3.
What are the key properties of 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate?
2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate has a molecular weight of 221.23 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethyl 4-amino-5-methylthiophene-2-carboxylate is sourced from PubChem (CID 61316388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).