About 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine
2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine (PubChem CID 61317701) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine |
| PubChem CID | 61317701 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine |
| SMILES | CC(C)C(N)c1ncon1 |
| InChI | InChI=1S/C6H11N3O/c1-4(2)5(7)6-8-3-10-9-6/h3-5H,7H2,1-2H3 |
| InChIKey | CVIXBBCQZLBQKL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine?
The IUPAC name of 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine (CID 61317701) is 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine.
What is the SMILES notation for 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine?
The canonical SMILES for 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine is CC(C)C(N)c1ncon1.
What is the InChIKey of 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine?
The InChIKey is CVIXBBCQZLBQKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-4(2)5(7)6-8-3-10-9-6/h3-5H,7H2,1-2H3.
What are the key properties of 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine?
2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine has a molecular weight of 141.17 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(1,2,4-oxadiazol-3-yl)propan-1-amine is sourced from PubChem (CID 61317701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).