6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid

C13H8Cl2N2O3 — CID 61317958

IUPAC6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)nc1
InChIInChI=1S/C13H8Cl2N2O3/c14-9-3-1-7(5-10(9)15)12(18)17-11-4-2-8(6-16-11)13(19)20/h1-6H,(H,19,20)(H,16,17,18)
InChIKeyYKWPQWRFZRXDKG-UHFFFAOYSA-N
MW311.12 g/mol
LogP3.34
Rot. Bonds3

About 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid

6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid (PubChem CID 61317958) has the molecular formula C13H8Cl2N2O3 and a molecular weight of 311.12 g/mol. Its IUPAC name is 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid
PubChem CID61317958
Molecular FormulaC13H8Cl2N2O3
Molecular Weight311.12 g/mol
Exact Mass309.99
IUPAC Name6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)nc1
InChIInChI=1S/C13H8Cl2N2O3/c14-9-3-1-7(5-10(9)15)12(18)17-11-4-2-8(6-16-11)13(19)20/h1-6H,(H,19,20)(H,16,17,18)
InChIKeyYKWPQWRFZRXDKG-UHFFFAOYSA-N
XLogP3.34
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.12
LogP ≤ 53.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid?
The IUPAC name of 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid (CID 61317958) is 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid is O=C(O)c1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)nc1.
What is the InChIKey of 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid?
The InChIKey is YKWPQWRFZRXDKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2N2O3/c14-9-3-1-7(5-10(9)15)12(18)17-11-4-2-8(6-16-11)13(19)20/h1-6H,(H,19,20)(H,16,17,18).
What are the key properties of 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid?
6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid has a molecular weight of 311.12 g/mol, XLogP of 3.34, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,4-dichlorobenzoyl)amino]pyridine-3-carboxylic acid is sourced from PubChem (CID 61317958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).