About 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one
2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one (PubChem CID 613184) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one |
| PubChem CID | 613184 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one |
| SMILES | CCCC(=O)C1=C(N2CCCC2)CC(C)(C)CC1=O |
| InChI | InChI=1S/C16H25NO2/c1-4-7-13(18)15-12(17-8-5-6-9-17)10-16(2,3)11-14(15)19/h4-11H2,1-3H3 |
| InChIKey | JYAGJIGLOWLZBQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one?
The IUPAC name of 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one (CID 613184) is 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one.
What is the SMILES notation for 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one?
The canonical SMILES for 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one is CCCC(=O)C1=C(N2CCCC2)CC(C)(C)CC1=O.
What is the InChIKey of 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one?
The InChIKey is JYAGJIGLOWLZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-4-7-13(18)15-12(17-8-5-6-9-17)10-16(2,3)11-14(15)19/h4-11H2,1-3H3.
What are the key properties of 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one?
2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one has a molecular weight of 263.38 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butanoyl-5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one is sourced from PubChem (CID 613184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).