C8H14N4O — CID 61318522
1-(oxolan-2-yl)-N-(2H-triazol-4-ylmethyl)methanamine (PubChem CID 61318522) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-(oxolan-2-yl)-N-(2H-triazol-4-ylmethyl)methanamine.
| Compound Name | 1-(oxolan-2-yl)-N-(2H-triazol-4-ylmethyl)methanamine |
|---|---|
| PubChem CID | 61318522 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-(oxolan-2-yl)-N-(2H-triazol-4-ylmethyl)methanamine |
| SMILES | c1n[nH]nc1CNCC1CCCO1 |
| InChI | InChI=1S/C8H14N4O/c1-2-8(13-3-1)6-9-4-7-5-10-12-11-7/h5,8-9H,1-4,6H2,(H,10,11,12) |
| InChIKey | RZZUCNXQTIHTOO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |