C14H12F3NO3 — CID 61318857
3-[[4-(trifluoromethoxy)anilino]methyl]benzene-1,2-diol (PubChem CID 61318857) has the molecular formula C14H12F3NO3 and a molecular weight of 299.25 g/mol. Its IUPAC name is 3-[[4-(trifluoromethoxy)anilino]methyl]benzene-1,2-diol.
| Compound Name | 3-[[4-(trifluoromethoxy)anilino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 61318857 |
| Molecular Formula | C14H12F3NO3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-[[4-(trifluoromethoxy)anilino]methyl]benzene-1,2-diol |
| SMILES | Oc1cccc(CNc2ccc(OC(F)(F)F)cc2)c1O |
| InChI | InChI=1S/C14H12F3NO3/c15-14(16,17)21-11-6-4-10(5-7-11)18-8-9-2-1-3-12(19)13(9)20/h1-7,18-20H,8H2 |
| InChIKey | WHHDLKKAIQNRMR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|