About 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine
5-piperidin-4-yl-1H-1,2,4-triazol-3-amine (PubChem CID 61320156) has the molecular formula C7H13N5
and a molecular weight of 167.22 g/mol. Its IUPAC name is 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 61320156 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(C2CCNCC2)n1 |
| InChI | InChI=1S/C7H13N5/c8-7-10-6(11-12-7)5-1-3-9-4-2-5/h5,9H,1-4H2,(H3,8,10,11,12) |
| InChIKey | CZJWKONMXKVEBV-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine (CID 61320156) is 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine is Nc1n[nH]c(C2CCNCC2)n1.
What is the InChIKey of 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine?
The InChIKey is CZJWKONMXKVEBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5/c8-7-10-6(11-12-7)5-1-3-9-4-2-5/h5,9H,1-4H2,(H3,8,10,11,12).
What are the key properties of 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine?
5-piperidin-4-yl-1H-1,2,4-triazol-3-amine has a molecular weight of 167.22 g/mol, XLogP of -0.15, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-4-yl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 61320156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).