About pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate
pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate (PubChem CID 61321044) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate |
| PubChem CID | 61321044 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)OCc2ccccn2)c(C)c1N |
| InChI | InChI=1S/C13H16N4O2/c1-9-13(14)10(2)17(16-9)7-12(18)19-8-11-5-3-4-6-15-11/h3-6H,7-8,14H2,1-2H3 |
| InChIKey | NZJQEFBRJGOHMO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The IUPAC name of pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate (CID 61321044) is pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate.
What is the SMILES notation for pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The canonical SMILES for pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate is Cc1nn(CC(=O)OCc2ccccn2)c(C)c1N.
What is the InChIKey of pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The InChIKey is NZJQEFBRJGOHMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c1-9-13(14)10(2)17(16-9)7-12(18)19-8-11-5-3-4-6-15-11/h3-6H,7-8,14H2,1-2H3.
What are the key properties of pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate has a molecular weight of 260.30 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate is sourced from PubChem (CID 61321044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).