About cyclohexylmethyl 2-(4-aminophenyl)acetate
cyclohexylmethyl 2-(4-aminophenyl)acetate (PubChem CID 61321508) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is cyclohexylmethyl 2-(4-aminophenyl)acetate.
Molecular Properties
| Compound Name | cyclohexylmethyl 2-(4-aminophenyl)acetate |
| PubChem CID | 61321508 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | cyclohexylmethyl 2-(4-aminophenyl)acetate |
| SMILES | Nc1ccc(CC(=O)OCC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H21NO2/c16-14-8-6-12(7-9-14)10-15(17)18-11-13-4-2-1-3-5-13/h6-9,13H,1-5,10-11,16H2 |
| InChIKey | PWTLWYUPIGUBJS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylmethyl 2-(4-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethyl 2-(4-aminophenyl)acetate?
The IUPAC name of cyclohexylmethyl 2-(4-aminophenyl)acetate (CID 61321508) is cyclohexylmethyl 2-(4-aminophenyl)acetate.
What is the SMILES notation for cyclohexylmethyl 2-(4-aminophenyl)acetate?
The canonical SMILES for cyclohexylmethyl 2-(4-aminophenyl)acetate is Nc1ccc(CC(=O)OCC2CCCCC2)cc1.
What is the InChIKey of cyclohexylmethyl 2-(4-aminophenyl)acetate?
The InChIKey is PWTLWYUPIGUBJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c16-14-8-6-12(7-9-14)10-15(17)18-11-13-4-2-1-3-5-13/h6-9,13H,1-5,10-11,16H2.
What are the key properties of cyclohexylmethyl 2-(4-aminophenyl)acetate?
cyclohexylmethyl 2-(4-aminophenyl)acetate has a molecular weight of 247.34 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethyl 2-(4-aminophenyl)acetate is sourced from PubChem (CID 61321508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).