C11H14BrN3S — CID 61323680
1-(5-bromothiophen-2-yl)-N-(2-imidazol-1-ylethyl)ethanamine (PubChem CID 61323680) has the molecular formula C11H14BrN3S and a molecular weight of 300.23 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N-(2-imidazol-1-ylethyl)ethanamine.
| Compound Name | 1-(5-bromothiophen-2-yl)-N-(2-imidazol-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 61323680 |
| Molecular Formula | C11H14BrN3S |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N-(2-imidazol-1-ylethyl)ethanamine |
| SMILES | CC(NCCn1ccnc1)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H14BrN3S/c1-9(10-2-3-11(12)16-10)14-5-7-15-6-4-13-8-15/h2-4,6,8-9,14H,5,7H2,1H3 |
| InChIKey | CFALGZJGGOUWMT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |