About [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine
[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine (PubChem CID 61323759) has the molecular formula C9H8IN3O
and a molecular weight of 301.09 g/mol. Its IUPAC name is [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine.
Molecular Properties
| Compound Name | [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine |
| PubChem CID | 61323759 |
| Molecular Formula | C9H8IN3O |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine |
| SMILES | NCc1noc(-c2ccc(I)cc2)n1 |
| InChI | InChI=1S/C9H8IN3O/c10-7-3-1-6(2-4-7)9-12-8(5-11)13-14-9/h1-4H,5,11H2 |
| InChIKey | DDJPFOUMCJFMLZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine?
The IUPAC name of [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine (CID 61323759) is [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine.
What is the SMILES notation for [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine?
The canonical SMILES for [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine is NCc1noc(-c2ccc(I)cc2)n1.
What is the InChIKey of [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine?
The InChIKey is DDJPFOUMCJFMLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8IN3O/c10-7-3-1-6(2-4-7)9-12-8(5-11)13-14-9/h1-4H,5,11H2.
What are the key properties of [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine?
[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine has a molecular weight of 301.09 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]methanamine is sourced from PubChem (CID 61323759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).